C14H17N5O3 — CID 94660700
ethyl (2S)-3-phenyl-2-[[2-(tetrazol-1-yl)acetyl]amino]propanoate (PubChem CID 94660700) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is ethyl (2S)-3-phenyl-2-[[2-(tetrazol-1-yl)acetyl]amino]propanoate.
| Compound Name | ethyl (2S)-3-phenyl-2-[[2-(tetrazol-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 94660700 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | ethyl (2S)-3-phenyl-2-[[2-(tetrazol-1-yl)acetyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)Cn1cnnn1 |
| InChI | InChI=1S/C14H17N5O3/c1-2-22-14(21)12(8-11-6-4-3-5-7-11)16-13(20)9-19-10-15-17-18-19/h3-7,10,12H,2,8-9H2,1H3,(H,16,20)/t12-/m0/s1 |
| InChIKey | WDXLRHFQFANEAU-LBPRGKRZSA-N |
| XLogP | -0.04 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |