C22H16F3NO2 — CID 102292035
5-(2,6-dimethylphenyl)-3-hydroxy-8-(trifluoromethyl)phenanthridin-6-one (PubChem CID 102292035) has the molecular formula C22H16F3NO2 and a molecular weight of 383.37 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-3-hydroxy-8-(trifluoromethyl)phenanthridin-6-one.
| Compound Name | 5-(2,6-dimethylphenyl)-3-hydroxy-8-(trifluoromethyl)phenanthridin-6-one |
|---|---|
| PubChem CID | 102292035 |
| Molecular Formula | C22H16F3NO2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-3-hydroxy-8-(trifluoromethyl)phenanthridin-6-one |
| SMILES | Cc1cccc(C)c1-n1c(=O)c2cc(C(F)(F)F)ccc2c2ccc(O)cc21 |
| InChI | InChI=1S/C22H16F3NO2/c1-12-4-3-5-13(2)20(12)26-19-11-15(27)7-9-17(19)16-8-6-14(22(23,24)25)10-18(16)21(26)28/h3-11,27H,1-2H3 |
| InChIKey | ZAJKEIHERQLZDS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|