C25H21F3N2O2 — CID 58986327
N-(2-ethyl-6-hydroxy-1-phenylindol-3-yl)-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 58986327) has the molecular formula C25H21F3N2O2 and a molecular weight of 438.45 g/mol. Its IUPAC name is N-(2-ethyl-6-hydroxy-1-phenylindol-3-yl)-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(2-ethyl-6-hydroxy-1-phenylindol-3-yl)-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 58986327 |
| Molecular Formula | C25H21F3N2O2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-(2-ethyl-6-hydroxy-1-phenylindol-3-yl)-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCc1c(NC(=O)Cc2ccc(C(F)(F)F)cc2)c2ccc(O)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C25H21F3N2O2/c1-2-21-24(29-23(32)14-16-8-10-17(11-9-16)25(26,27)28)20-13-12-19(31)15-22(20)30(21)18-6-4-3-5-7-18/h3-13,15,31H,2,14H2,1H3,(H,29,32) |
| InChIKey | XRCWBLMAAFJZDA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |