C17H17NO3 — CID 164598717
5-tert-butyl-3,8-dihydroxyphenanthridin-6-one (PubChem CID 164598717) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-tert-butyl-3,8-dihydroxyphenanthridin-6-one.
| Compound Name | 5-tert-butyl-3,8-dihydroxyphenanthridin-6-one |
|---|---|
| PubChem CID | 164598717 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 5-tert-butyl-3,8-dihydroxyphenanthridin-6-one |
| SMILES | CC(C)(C)n1c(=O)c2cc(O)ccc2c2ccc(O)cc21 |
| InChI | InChI=1S/C17H17NO3/c1-17(2,3)18-15-9-11(20)5-7-13(15)12-6-4-10(19)8-14(12)16(18)21/h4-9,19-20H,1-3H3 |
| InChIKey | ZUCJVJSIYSQPKH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|