About 9-hydroxycarbazole-2,7-diol
9-hydroxycarbazole-2,7-diol (PubChem CID 118518273) has the molecular formula C12H9NO3
and a molecular weight of 215.21 g/mol. Its IUPAC name is 9-hydroxycarbazole-2,7-diol.
Molecular Properties
| Compound Name | 9-hydroxycarbazole-2,7-diol |
| PubChem CID | 118518273 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 9-hydroxycarbazole-2,7-diol |
| SMILES | Oc1ccc2c3ccc(O)cc3n(O)c2c1 |
| InChI | InChI=1S/C12H9NO3/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16)11(9)5-7/h1-6,14-16H |
| InChIKey | VWSZBDAFRGCQOS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxycarbazole-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxycarbazole-2,7-diol?
The IUPAC name of 9-hydroxycarbazole-2,7-diol (CID 118518273) is 9-hydroxycarbazole-2,7-diol.
What is the SMILES notation for 9-hydroxycarbazole-2,7-diol?
The canonical SMILES for 9-hydroxycarbazole-2,7-diol is Oc1ccc2c3ccc(O)cc3n(O)c2c1.
What is the InChIKey of 9-hydroxycarbazole-2,7-diol?
The InChIKey is VWSZBDAFRGCQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16)11(9)5-7/h1-6,14-16H.
What are the key properties of 9-hydroxycarbazole-2,7-diol?
9-hydroxycarbazole-2,7-diol has a molecular weight of 215.21 g/mol, XLogP of 2.44, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxycarbazole-2,7-diol is sourced from PubChem (CID 118518273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).