About 1-methoxyindol-6-ol
1-methoxyindol-6-ol (PubChem CID 69254132) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 1-methoxyindol-6-ol.
Molecular Properties
| Compound Name | 1-methoxyindol-6-ol |
| PubChem CID | 69254132 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 1-methoxyindol-6-ol |
| SMILES | COn1ccc2ccc(O)cc21 |
| InChI | InChI=1S/C9H9NO2/c1-12-10-5-4-7-2-3-8(11)6-9(7)10/h2-6,11H,1H3 |
| InChIKey | NJRPJGPJZAYIFQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxyindol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyindol-6-ol?
The IUPAC name of 1-methoxyindol-6-ol (CID 69254132) is 1-methoxyindol-6-ol.
What is the SMILES notation for 1-methoxyindol-6-ol?
The canonical SMILES for 1-methoxyindol-6-ol is COn1ccc2ccc(O)cc21.
What is the InChIKey of 1-methoxyindol-6-ol?
The InChIKey is NJRPJGPJZAYIFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-12-10-5-4-7-2-3-8(11)6-9(7)10/h2-6,11H,1H3.
What are the key properties of 1-methoxyindol-6-ol?
1-methoxyindol-6-ol has a molecular weight of 163.18 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyindol-6-ol is sourced from PubChem (CID 69254132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).