About ethane;9-hydroxycarbazole
ethane;9-hydroxycarbazole (PubChem CID 153391260) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is ethane;9-hydroxycarbazole.
Molecular Properties
| Compound Name | ethane;9-hydroxycarbazole |
| PubChem CID | 153391260 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | ethane;9-hydroxycarbazole |
| SMILES | CC.On1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C12H9NO.C2H6/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;1-2/h1-8,14H;1-2H3 |
| InChIKey | AQCDOLCDMMDLJL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethane;9-hydroxycarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-hydroxycarbazole?
The IUPAC name of ethane;9-hydroxycarbazole (CID 153391260) is ethane;9-hydroxycarbazole.
What is the SMILES notation for ethane;9-hydroxycarbazole?
The canonical SMILES for ethane;9-hydroxycarbazole is CC.On1c2ccccc2c2ccccc21.
What is the InChIKey of ethane;9-hydroxycarbazole?
The InChIKey is AQCDOLCDMMDLJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO.C2H6/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;1-2/h1-8,14H;1-2H3.
What are the key properties of ethane;9-hydroxycarbazole?
ethane;9-hydroxycarbazole has a molecular weight of 213.28 g/mol, XLogP of 4.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-hydroxycarbazole is sourced from PubChem (CID 153391260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).