C25H21N5O5 — CID 155891788
3-[3-[[[1-(3,4-dimethylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]amino]-nitrosoamino]-2-hydroxyphenyl]benzoic acid (PubChem CID 155891788) has the molecular formula C25H21N5O5 and a molecular weight of 471.47 g/mol. Its IUPAC name is 3-[3-[[[1-(3,4-dimethylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]amino]-nitrosoamino]-2-hydroxyphenyl]benzoic acid.
| Compound Name | 3-[3-[[[1-(3,4-dimethylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]amino]-nitrosoamino]-2-hydroxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 155891788 |
| Molecular Formula | C25H21N5O5 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 3-[3-[[[1-(3,4-dimethylphenyl)-3-methyl-5-oxopyrazol-4-ylidene]amino]-nitrosoamino]-2-hydroxyphenyl]benzoic acid |
| SMILES | CC1=NN(c2ccc(C)c(C)c2)C(=O)C1=NN(N=O)c1cccc(-c2cccc(C(=O)O)c2)c1O |
| InChI | InChI=1S/C25H21N5O5/c1-14-10-11-19(12-15(14)2)29-24(32)22(16(3)26-29)27-30(28-35)21-9-5-8-20(23(21)31)17-6-4-7-18(13-17)25(33)34/h4-13,31H,1-3H3,(H,33,34) |
| InChIKey | VPFKOECCASNKNT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 135.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|