C23H13F5N4O3 — CID 10184772
3-[3-[[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid (PubChem CID 10184772) has the molecular formula C23H13F5N4O3 and a molecular weight of 488.37 g/mol. Its IUPAC name is 3-[3-[[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid.
| Compound Name | 3-[3-[[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 10184772 |
| Molecular Formula | C23H13F5N4O3 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 3-[3-[[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)-4H-pyrazol-4-yl]diazenyl]phenyl]benzoic acid |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)C1/N=N/c1cccc(-c2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C23H13F5N4O3/c1-10-20(22(33)32(31-10)21-18(27)16(25)15(24)17(26)19(21)28)30-29-14-7-3-5-12(9-14)11-4-2-6-13(8-11)23(34)35/h2-9,20H,1H3,(H,34,35)/b30-29+ |
| InChIKey | UMSKQGQMTKOYMO-QVIHXGFCSA-N |
| XLogP | 5.62 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|