C23H16N4O2S — CID 11603982
3-[(4,6-diphenyl-2-sulfanylidene-5H-pyrimidin-5-yl)diazenyl]benzoic acid (PubChem CID 11603982) has the molecular formula C23H16N4O2S and a molecular weight of 412.47 g/mol. Its IUPAC name is 3-[(4,6-diphenyl-2-sulfanylidene-5H-pyrimidin-5-yl)diazenyl]benzoic acid.
| Compound Name | 3-[(4,6-diphenyl-2-sulfanylidene-5H-pyrimidin-5-yl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 11603982 |
| Molecular Formula | C23H16N4O2S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 3-[(4,6-diphenyl-2-sulfanylidene-5H-pyrimidin-5-yl)diazenyl]benzoic acid |
| SMILES | O=C(O)c1cccc(/N=N/C2C(c3ccccc3)=NC(=S)N=C2c2ccccc2)c1 |
| InChI | InChI=1S/C23H16N4O2S/c28-22(29)17-12-7-13-18(14-17)26-27-21-19(15-8-3-1-4-9-15)24-23(30)25-20(21)16-10-5-2-6-11-16/h1-14,21H,(H,28,29)/b27-26+ |
| InChIKey | CHIGIGUQZGPNQR-CYYJNZCTSA-N |
| XLogP | 5.11 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|