C23H18N4OS — CID 11516842
5-[(3-methoxyphenyl)diazenyl]-4,6-diphenyl-5H-pyrimidine-2-thione (PubChem CID 11516842) has the molecular formula C23H18N4OS and a molecular weight of 398.49 g/mol. Its IUPAC name is 5-[(3-methoxyphenyl)diazenyl]-4,6-diphenyl-5H-pyrimidine-2-thione.
| Compound Name | 5-[(3-methoxyphenyl)diazenyl]-4,6-diphenyl-5H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 11516842 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 5-[(3-methoxyphenyl)diazenyl]-4,6-diphenyl-5H-pyrimidine-2-thione |
| SMILES | COc1cccc(/N=N/C2C(c3ccccc3)=NC(=S)N=C2c2ccccc2)c1 |
| InChI | InChI=1S/C23H18N4OS/c1-28-19-14-8-13-18(15-19)26-27-22-20(16-9-4-2-5-10-16)24-23(29)25-21(22)17-11-6-3-7-12-17/h2-15,22H,1H3/b27-26+ |
| InChIKey | YOJAQPHLMIDQEX-CYYJNZCTSA-N |
| XLogP | 5.42 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|