C16H13Cl2N4O7S2+ — CID 123490730
2,5-dichloro-4-[3-methyl-5-oxo-4-[(4-sulfophenyl)diazenyl]-4H-pyrazol-2-ium-1-yl]benzenesulfonic acid (PubChem CID 123490730) has the molecular formula C16H13Cl2N4O7S2+ and a molecular weight of 508.34 g/mol. Its IUPAC name is 2,5-dichloro-4-[3-methyl-5-oxo-4-[(4-sulfophenyl)diazenyl]-4H-pyrazol-2-ium-1-yl]benzenesulfonic acid.
| Compound Name | 2,5-dichloro-4-[3-methyl-5-oxo-4-[(4-sulfophenyl)diazenyl]-4H-pyrazol-2-ium-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 123490730 |
| Molecular Formula | C16H13Cl2N4O7S2+ |
| Molecular Weight | 508.34 g/mol |
| Exact Mass | 506.96 |
| IUPAC Name | 2,5-dichloro-4-[3-methyl-5-oxo-4-[(4-sulfophenyl)diazenyl]-4H-pyrazol-2-ium-1-yl]benzenesulfonic acid |
| SMILES | CC1=[NH+]N(c2cc(Cl)c(S(=O)(=O)O)cc2Cl)C(=O)C1/N=N/c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H12Cl2N4O7S2/c1-8-15(20-19-9-2-4-10(5-3-9)30(24,25)26)16(23)22(21-8)13-6-12(18)14(7-11(13)17)31(27,28)29/h2-7,15H,1H3,(H,24,25,26)(H,27,28,29)/p+1/b20-19+ |
| InChIKey | DWYWPBYWDAZKNX-FMQUCBEESA-O |
| XLogP | 1.44 |
| TPSA | 167.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|