C26H19N6NaO6S — CID 136917485
sodium 2-[[2-hydroxy-7-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]naphthalen-1-yl]diazenyl]-4-sulfophenolate (PubChem CID 136917485) has the molecular formula C26H19N6NaO6S and a molecular weight of 566.53 g/mol. Its IUPAC name is sodium 2-[[2-hydroxy-7-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]naphthalen-1-yl]diazenyl]-4-sulfophenolate.
| Compound Name | sodium 2-[[2-hydroxy-7-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]naphthalen-1-yl]diazenyl]-4-sulfophenolate |
|---|---|
| PubChem CID | 136917485 |
| Molecular Formula | C26H19N6NaO6S |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | sodium 2-[[2-hydroxy-7-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]naphthalen-1-yl]diazenyl]-4-sulfophenolate |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1/N=N/c1ccc2ccc(O)c(/N=N/c3cc(S(=O)(=O)O)ccc3[O-])c2c1.[Na+] |
| InChI | InChI=1S/C26H20N6O6S.Na/c1-15-24(26(35)32(31-15)18-5-3-2-4-6-18)29-27-17-9-7-16-8-11-23(34)25(20(16)13-17)30-28-21-14-19(39(36,37)38)10-12-22(21)33;/h2-14,24,33-34H,1H3,(H,36,37,38);/q;+1/p-1/b29-27+,30-28+; |
| InChIKey | NZDTUJRRBCROKT-MANJTEISSA-M |
| XLogP | 2.16 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|