C16H21N3O5S — CID 95704899
4-[(4R)-3-heptyl-4-nitroso-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid (PubChem CID 95704899) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 4-[(4R)-3-heptyl-4-nitroso-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid.
| Compound Name | 4-[(4R)-3-heptyl-4-nitroso-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 95704899 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 4-[(4R)-3-heptyl-4-nitroso-5-oxo-4H-pyrazol-1-yl]benzenesulfonic acid |
| SMILES | CCCCCCCC1=NN(c2ccc(S(=O)(=O)O)cc2)C(=O)[C@@H]1N=O |
| InChI | InChI=1S/C16H21N3O5S/c1-2-3-4-5-6-7-14-15(18-21)16(20)19(17-14)12-8-10-13(11-9-12)25(22,23)24/h8-11,15H,2-7H2,1H3,(H,22,23,24)/t15-/m1/s1 |
| InChIKey | DCRGCQORNJUMDP-OAHLLOKOSA-N |
| XLogP | 3.13 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|