C12H12N6O2S — CID 3819848
4-[(1-carbamothioyl-3-methyl-5-oxo-4H-pyrazol-4-yl)diazenyl]benzamide (PubChem CID 3819848) has the molecular formula C12H12N6O2S and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-[(1-carbamothioyl-3-methyl-5-oxo-4H-pyrazol-4-yl)diazenyl]benzamide.
| Compound Name | 4-[(1-carbamothioyl-3-methyl-5-oxo-4H-pyrazol-4-yl)diazenyl]benzamide |
|---|---|
| PubChem CID | 3819848 |
| Molecular Formula | C12H12N6O2S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 4-[(1-carbamothioyl-3-methyl-5-oxo-4H-pyrazol-4-yl)diazenyl]benzamide |
| SMILES | CC1=NN(C(N)=S)C(=O)C1/N=N/c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C12H12N6O2S/c1-6-9(11(20)18(17-6)12(14)21)16-15-8-4-2-7(3-5-8)10(13)19/h2-5,9H,1H3,(H2,13,19)(H2,14,21)/b16-15+ |
| InChIKey | YRKQPRFNNZVKNM-FOCLMDBBSA-N |
| XLogP | 0.70 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|