C21H19N7O3 — CID 98537888
1,5-dimethyl-4-[[(4S)-3-methyl-5-oxo-1-(pyridine-4-carbonyl)-4H-pyrazol-4-yl]diazenyl]-2-phenylpyrazol-3-one (PubChem CID 98537888) has the molecular formula C21H19N7O3 and a molecular weight of 417.43 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[(4S)-3-methyl-5-oxo-1-(pyridine-4-carbonyl)-4H-pyrazol-4-yl]diazenyl]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[[(4S)-3-methyl-5-oxo-1-(pyridine-4-carbonyl)-4H-pyrazol-4-yl]diazenyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 98537888 |
| Molecular Formula | C21H19N7O3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1,5-dimethyl-4-[[(4S)-3-methyl-5-oxo-1-(pyridine-4-carbonyl)-4H-pyrazol-4-yl]diazenyl]-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(C(=O)c2ccncc2)C(=O)[C@H]1/N=N/c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C21H19N7O3/c1-13-17(20(30)27(25-13)19(29)15-9-11-22-12-10-15)23-24-18-14(2)26(3)28(21(18)31)16-7-5-4-6-8-16/h4-12,17H,1-3H3/b24-23+/t17-/m0/s1 |
| InChIKey | PPLIHMCGXWXRRN-LRDZBDLTSA-N |
| XLogP | 2.39 |
| TPSA | 114.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|