C21H17N5O7 — CID 98540984
2-[[(4R)-1-[3-(4-carboxyanilino)-3-oxopropanoyl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzoic acid (PubChem CID 98540984) has the molecular formula C21H17N5O7 and a molecular weight of 451.40 g/mol. Its IUPAC name is 2-[[(4R)-1-[3-(4-carboxyanilino)-3-oxopropanoyl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzoic acid.
| Compound Name | 2-[[(4R)-1-[3-(4-carboxyanilino)-3-oxopropanoyl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 98540984 |
| Molecular Formula | C21H17N5O7 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-[[(4R)-1-[3-(4-carboxyanilino)-3-oxopropanoyl]-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzoic acid |
| SMILES | CC1=NN(C(=O)CC(=O)Nc2ccc(C(=O)O)cc2)C(=O)[C@@H]1/N=N/c1ccccc1C(=O)O |
| InChI | InChI=1S/C21H17N5O7/c1-11-18(24-23-15-5-3-2-4-14(15)21(32)33)19(29)26(25-11)17(28)10-16(27)22-13-8-6-12(7-9-13)20(30)31/h2-9,18H,10H2,1H3,(H,22,27)(H,30,31)(H,32,33)/b24-23+/t18-/m1/s1 |
| InChIKey | JLNYJNUKSALTHI-IUBFCHALSA-N |
| XLogP | 2.31 |
| TPSA | 178.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|