C18H14N3O6- — CID 152777341
4-(4-carboxyanilino)-3-[(2-carboxyphenyl)diazenyl]-4-oxobut-2-en-2-olate (PubChem CID 152777341) has the molecular formula C18H14N3O6- and a molecular weight of 368.33 g/mol. Its IUPAC name is 4-(4-carboxyanilino)-3-[(2-carboxyphenyl)diazenyl]-4-oxobut-2-en-2-olate.
| Compound Name | 4-(4-carboxyanilino)-3-[(2-carboxyphenyl)diazenyl]-4-oxobut-2-en-2-olate |
|---|---|
| PubChem CID | 152777341 |
| Molecular Formula | C18H14N3O6- |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-(4-carboxyanilino)-3-[(2-carboxyphenyl)diazenyl]-4-oxobut-2-en-2-olate |
| SMILES | CC([O-])=C(/N=N/c1ccccc1C(=O)O)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H15N3O6/c1-10(22)15(21-20-14-5-3-2-4-13(14)18(26)27)16(23)19-12-8-6-11(7-9-12)17(24)25/h2-9,22H,1H3,(H,19,23)(H,24,25)(H,26,27)/p-1/b15-10?,21-20+ |
| InChIKey | WZYLIWZVOODZRH-RQDBAKESSA-M |
| XLogP | 2.40 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|