C12H10N3O6- — CID 135696460
(Z)-3-[(4-carboxy-2-nitrophenyl)diazenyl]-4-oxopent-2-en-2-olate (PubChem CID 135696460) has the molecular formula C12H10N3O6- and a molecular weight of 292.23 g/mol. Its IUPAC name is (Z)-3-[(4-carboxy-2-nitrophenyl)diazenyl]-4-oxopent-2-en-2-olate.
| Compound Name | (Z)-3-[(4-carboxy-2-nitrophenyl)diazenyl]-4-oxopent-2-en-2-olate |
|---|---|
| PubChem CID | 135696460 |
| Molecular Formula | C12H10N3O6- |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (Z)-3-[(4-carboxy-2-nitrophenyl)diazenyl]-4-oxopent-2-en-2-olate |
| SMILES | CC(=O)C(/N=N/c1ccc(C(=O)O)cc1[N+](=O)[O-])=C(\C)[O-] |
| InChI | InChI=1S/C12H11N3O6/c1-6(16)11(7(2)17)14-13-9-4-3-8(12(18)19)5-10(9)15(20)21/h3-5,16H,1-2H3,(H,18,19)/p-1/b11-6-,14-13+ |
| InChIKey | CYHQIGQWNCESOT-MVKBROMJSA-M |
| XLogP | 1.56 |
| TPSA | 145.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|