C19H18N4O4S — CID 174004697
2-[[3-hydroxy-1-[[2-(methylideneamino)phenyl]sulfanylmethylamino]-1-oxobut-2-en-2-yl]diazenyl]benzoic acid (PubChem CID 174004697) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-[[3-hydroxy-1-[[2-(methylideneamino)phenyl]sulfanylmethylamino]-1-oxobut-2-en-2-yl]diazenyl]benzoic acid.
| Compound Name | 2-[[3-hydroxy-1-[[2-(methylideneamino)phenyl]sulfanylmethylamino]-1-oxobut-2-en-2-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 174004697 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[[3-hydroxy-1-[[2-(methylideneamino)phenyl]sulfanylmethylamino]-1-oxobut-2-en-2-yl]diazenyl]benzoic acid |
| SMILES | C=Nc1ccccc1SCNC(=O)C(/N=N/c1ccccc1C(=O)O)=C(C)O |
| InChI | InChI=1S/C19H18N4O4S/c1-12(24)17(23-22-14-8-4-3-7-13(14)19(26)27)18(25)21-11-28-16-10-6-5-9-15(16)20-2/h3-10,24H,2,11H2,1H3,(H,21,25)(H,26,27)/b17-12?,23-22+ |
| InChIKey | OTFAUZIMIDYOGH-LMVJBXDJSA-N |
| XLogP | 4.46 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|