C17H24N2O2S — CID 143772121
(Z)-3,4-dimethylhex-3-ene-2,5-dione;N-methyl-1-[2-(methylideneamino)phenyl]sulfanylmethanamine (PubChem CID 143772121) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is (Z)-3,4-dimethylhex-3-ene-2,5-dione;N-methyl-1-[2-(methylideneamino)phenyl]sulfanylmethanamine.
| Compound Name | (Z)-3,4-dimethylhex-3-ene-2,5-dione;N-methyl-1-[2-(methylideneamino)phenyl]sulfanylmethanamine |
|---|---|
| PubChem CID | 143772121 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (Z)-3,4-dimethylhex-3-ene-2,5-dione;N-methyl-1-[2-(methylideneamino)phenyl]sulfanylmethanamine |
| SMILES | C=Nc1ccccc1SCNC.CC(=O)/C(C)=C(/C)C(C)=O |
| InChI | InChI=1S/C9H12N2S.C8H12O2/c1-10-7-12-9-6-4-3-5-8(9)11-2;1-5(7(3)9)6(2)8(4)10/h3-6,10H,2,7H2,1H3;1-4H3/b;6-5- |
| InChIKey | QYGBLBVNYHFDCU-JXGYXAOLSA-N |
| XLogP | 3.79 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|