C19H28N2OS3 — CID 142992117
S-[[2-(methylideneamino)phenyl]sulfanylmethyl] 2-(2-ethylsulfanylhex-1-en-3-ylamino)propanethioate (PubChem CID 142992117) has the molecular formula C19H28N2OS3 and a molecular weight of 396.65 g/mol. Its IUPAC name is S-[[2-(methylideneamino)phenyl]sulfanylmethyl] 2-(2-ethylsulfanylhex-1-en-3-ylamino)propanethioate.
| Compound Name | S-[[2-(methylideneamino)phenyl]sulfanylmethyl] 2-(2-ethylsulfanylhex-1-en-3-ylamino)propanethioate |
|---|---|
| PubChem CID | 142992117 |
| Molecular Formula | C19H28N2OS3 |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | S-[[2-(methylideneamino)phenyl]sulfanylmethyl] 2-(2-ethylsulfanylhex-1-en-3-ylamino)propanethioate |
| SMILES | C=Nc1ccccc1SCSC(=O)C(C)NC(CCC)C(=C)SCC |
| InChI | InChI=1S/C19H28N2OS3/c1-6-10-16(15(4)23-7-2)21-14(3)19(22)25-13-24-18-12-9-8-11-17(18)20-5/h8-9,11-12,14,16,21H,4-7,10,13H2,1-3H3 |
| InChIKey | YTFUSHHPLZVECP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|