C15H22N4O2S — CID 143418669
3-hydrazinyl-N-[2-[2-(methylideneamino)phenyl]sulfanylethyl]-2-oxohexanamide (PubChem CID 143418669) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 3-hydrazinyl-N-[2-[2-(methylideneamino)phenyl]sulfanylethyl]-2-oxohexanamide.
| Compound Name | 3-hydrazinyl-N-[2-[2-(methylideneamino)phenyl]sulfanylethyl]-2-oxohexanamide |
|---|---|
| PubChem CID | 143418669 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 3-hydrazinyl-N-[2-[2-(methylideneamino)phenyl]sulfanylethyl]-2-oxohexanamide |
| SMILES | C=Nc1ccccc1SCCNC(=O)C(=O)C(CCC)NN |
| InChI | InChI=1S/C15H22N4O2S/c1-3-6-12(19-16)14(20)15(21)18-9-10-22-13-8-5-4-7-11(13)17-2/h4-5,7-8,12,19H,2-3,6,9-10,16H2,1H3,(H,18,21) |
| InChIKey | SLUJZQQPARTDER-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|