C20H29N3O5 — CID 142090678
propan-2-yl 2-[[2-[[3-(methylamino)-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate (PubChem CID 142090678) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[[3-(methylamino)-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate.
| Compound Name | propan-2-yl 2-[[2-[[3-(methylamino)-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 142090678 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | propan-2-yl 2-[[2-[[3-(methylamino)-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate |
| SMILES | CCCC(NC)C(=O)C(=O)NCC(=O)NC(C(=O)OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H29N3O5/c1-5-9-15(21-4)18(25)19(26)22-12-16(24)23-17(20(27)28-13(2)3)14-10-7-6-8-11-14/h6-8,10-11,13,15,17,21H,5,9,12H2,1-4H3,(H,22,26)(H,23,24) |
| InChIKey | NDXXTRACDAMELD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|