C18H26N4O4 — CID 70315104
3-amino-5-methyl-N-[2-[[2-(methylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-2-oxohexanamide (PubChem CID 70315104) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-amino-5-methyl-N-[2-[[2-(methylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-2-oxohexanamide.
| Compound Name | 3-amino-5-methyl-N-[2-[[2-(methylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-2-oxohexanamide |
|---|---|
| PubChem CID | 70315104 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-amino-5-methyl-N-[2-[[2-(methylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-2-oxohexanamide |
| SMILES | CNC(=O)C(NC(=O)CNC(=O)C(=O)C(N)CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H26N4O4/c1-11(2)9-13(19)16(24)18(26)21-10-14(23)22-15(17(25)20-3)12-7-5-4-6-8-12/h4-8,11,13,15H,9-10,19H2,1-3H3,(H,20,25)(H,21,26)(H,22,23) |
| InChIKey | YTTCTXAJRNZJEI-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|