C17H26N4O4 — CID 59979466
3-amino-2-hydroxy-N-[2-[[(1S)-2-(methylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]hexanamide (PubChem CID 59979466) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-amino-2-hydroxy-N-[2-[[(1S)-2-(methylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]hexanamide.
| Compound Name | 3-amino-2-hydroxy-N-[2-[[(1S)-2-(methylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 59979466 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3-amino-2-hydroxy-N-[2-[[(1S)-2-(methylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]hexanamide |
| SMILES | CCCC(N)C(O)C(=O)NCC(=O)N[C@H](C(=O)NC)c1ccccc1 |
| InChI | InChI=1S/C17H26N4O4/c1-3-7-12(18)15(23)17(25)20-10-13(22)21-14(16(24)19-2)11-8-5-4-6-9-11/h4-6,8-9,12,14-15,23H,3,7,10,18H2,1-2H3,(H,19,24)(H,20,25)(H,21,22)/t12?,14-,15?/m0/s1 |
| InChIKey | RKGLVVIPIJHZOB-BLZCZZARSA-N |
| XLogP | -0.81 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |