C17H24N4O6 — CID 68554414
[(3S)-1-[[2-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-2-oxoethyl]amino]-2-hydroxy-1-oxohexan-3-yl]carbamic acid (PubChem CID 68554414) has the molecular formula C17H24N4O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is [(3S)-1-[[2-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-2-oxoethyl]amino]-2-hydroxy-1-oxohexan-3-yl]carbamic acid.
| Compound Name | [(3S)-1-[[2-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-2-oxoethyl]amino]-2-hydroxy-1-oxohexan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68554414 |
| Molecular Formula | C17H24N4O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [(3S)-1-[[2-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-2-oxoethyl]amino]-2-hydroxy-1-oxohexan-3-yl]carbamic acid |
| SMILES | CCC[C@H](NC(=O)O)C(O)C(=O)NCC(=O)N[C@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C17H24N4O6/c1-2-6-11(20-17(26)27)14(23)16(25)19-9-12(22)21-13(15(18)24)10-7-4-3-5-8-10/h3-5,7-8,11,13-14,20,23H,2,6,9H2,1H3,(H2,18,24)(H,19,25)(H,21,22)(H,26,27)/t11-,13-,14?/m0/s1 |
| InChIKey | FLOYTKPSDOGGPB-ULVQEXTCSA-N |
| XLogP | -0.76 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |