C36H47N6O8P — CID 59978696
phosphanyl (2S)-2-[[2-[[3-[[1-benzyl-3-[2-cyclohexyl-2-(methylamino)acetyl]-2-oxoimidazolidine-4-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate (PubChem CID 59978696) has the molecular formula C36H47N6O8P and a molecular weight of 722.78 g/mol. Its IUPAC name is phosphanyl (2S)-2-[[2-[[3-[[1-benzyl-3-[2-cyclohexyl-2-(methylamino)acetyl]-2-oxoimidazolidine-4-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate.
| Compound Name | phosphanyl (2S)-2-[[2-[[3-[[1-benzyl-3-[2-cyclohexyl-2-(methylamino)acetyl]-2-oxoimidazolidine-4-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 59978696 |
| Molecular Formula | C36H47N6O8P |
| Molecular Weight | 722.78 g/mol |
| Exact Mass | 722.32 |
| IUPAC Name | phosphanyl (2S)-2-[[2-[[3-[[1-benzyl-3-[2-cyclohexyl-2-(methylamino)acetyl]-2-oxoimidazolidine-4-carbonyl]amino]-2-oxohexanoyl]amino]acetyl]amino]-2-phenylacetate |
| SMILES | CCCC(NC(=O)C1CN(Cc2ccccc2)C(=O)N1C(=O)C(NC)C1CCCCC1)C(=O)C(=O)NCC(=O)N[C@H](C(=O)OP)c1ccccc1 |
| InChI | InChI=1S/C36H47N6O8P/c1-3-13-26(31(44)33(46)38-20-28(43)40-30(35(48)50-51)25-18-11-6-12-19-25)39-32(45)27-22-41(21-23-14-7-4-8-15-23)36(49)42(27)34(47)29(37-2)24-16-9-5-10-17-24/h4,6-8,11-12,14-15,18-19,24,26-27,29-30,37H,3,5,9-10,13,16-17,20-22,51H2,1-2H3,(H,38,46)(H,39,45)(H,40,43)/t26?,27?,29?,30-/m0/s1 |
| InChIKey | NOADRXYTPRWCPV-PFMXCZMRSA-N |
| XLogP | 2.15 |
| TPSA | 183.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.78 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|