C19H26F2N4O4 — CID 143315083
N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-6,6-difluoro-3-(methylamino)-2-oxohexanamide (PubChem CID 143315083) has the molecular formula C19H26F2N4O4 and a molecular weight of 412.44 g/mol. Its IUPAC name is N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-6,6-difluoro-3-(methylamino)-2-oxohexanamide.
| Compound Name | N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-6,6-difluoro-3-(methylamino)-2-oxohexanamide |
|---|---|
| PubChem CID | 143315083 |
| Molecular Formula | C19H26F2N4O4 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-6,6-difluoro-3-(methylamino)-2-oxohexanamide |
| SMILES | CNC(CCC(F)F)C(=O)C(=O)NCC(=O)NC(C(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H26F2N4O4/c1-22-13(9-10-14(20)21)17(27)18(28)23-11-15(26)24-16(19(29)25(2)3)12-7-5-4-6-8-12/h4-8,13-14,16,22H,9-11H2,1-3H3,(H,23,28)(H,24,26) |
| InChIKey | OVAFYKQTZZKNFZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|