C16H20N4O5 — CID 142091069
N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-3-formamido-2-oxopropanamide (PubChem CID 142091069) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-3-formamido-2-oxopropanamide.
| Compound Name | N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-3-formamido-2-oxopropanamide |
|---|---|
| PubChem CID | 142091069 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]-2-oxoethyl]-3-formamido-2-oxopropanamide |
| SMILES | CN(C)C(=O)C(NC(=O)CNC(=O)C(=O)CNC=O)c1ccccc1 |
| InChI | InChI=1S/C16H20N4O5/c1-20(2)16(25)14(11-6-4-3-5-7-11)19-13(23)9-18-15(24)12(22)8-17-10-21/h3-7,10,14H,8-9H2,1-2H3,(H,17,21)(H,18,24)(H,19,23) |
| InChIKey | JQSFIASGXMVRCJ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|