C22H30N4O3 — CID 142090994
2-cyclopropylidene-N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]pent-2-enyl]-3-formamidopropanamide (PubChem CID 142090994) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-cyclopropylidene-N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]pent-2-enyl]-3-formamidopropanamide.
| Compound Name | 2-cyclopropylidene-N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]pent-2-enyl]-3-formamidopropanamide |
|---|---|
| PubChem CID | 142090994 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-cyclopropylidene-N-[2-[[2-(dimethylamino)-2-oxo-1-phenylethyl]amino]pent-2-enyl]-3-formamidopropanamide |
| SMILES | CCC=C(CNC(=O)C(CNC=O)=C1CC1)NC(C(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H30N4O3/c1-4-8-18(13-24-21(28)19(14-23-15-27)16-11-12-16)25-20(22(29)26(2)3)17-9-6-5-7-10-17/h5-10,15,20,25H,4,11-14H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | YZHBEEDYZTYWMR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|