C25H39N3O4 — CID 142091261
tert-butyl 2-[[(E)-1-[2-(1-formamidoethyl)pentanoylamino]pent-2-en-2-yl]amino]-2-phenylacetate (PubChem CID 142091261) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is tert-butyl 2-[[(E)-1-[2-(1-formamidoethyl)pentanoylamino]pent-2-en-2-yl]amino]-2-phenylacetate.
| Compound Name | tert-butyl 2-[[(E)-1-[2-(1-formamidoethyl)pentanoylamino]pent-2-en-2-yl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 142091261 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | tert-butyl 2-[[(E)-1-[2-(1-formamidoethyl)pentanoylamino]pent-2-en-2-yl]amino]-2-phenylacetate |
| SMILES | CC/C=C(\CNC(=O)C(CCC)C(C)NC=O)NC(C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H39N3O4/c1-7-12-20(16-26-23(30)21(13-8-2)18(3)27-17-29)28-22(19-14-10-9-11-15-19)24(31)32-25(4,5)6/h9-12,14-15,17-18,21-22,28H,7-8,13,16H2,1-6H3,(H,26,30)(H,27,29)/b20-12+ |
| InChIKey | NSLMWOSEGGTDDG-UDWIEESQSA-N |
| XLogP | 3.62 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|