C13H17N3O3 — CID 143314684
2-[(2-formamidoacetyl)amino]-N,N-dimethyl-2-phenylacetamide (PubChem CID 143314684) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-[(2-formamidoacetyl)amino]-N,N-dimethyl-2-phenylacetamide.
| Compound Name | 2-[(2-formamidoacetyl)amino]-N,N-dimethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 143314684 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-[(2-formamidoacetyl)amino]-N,N-dimethyl-2-phenylacetamide |
| SMILES | CN(C)C(=O)C(NC(=O)CNC=O)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O3/c1-16(2)13(19)12(10-6-4-3-5-7-10)15-11(18)8-14-9-17/h3-7,9,12H,8H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | YCQBZVLEEWLPMM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|