About ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine
ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine (PubChem CID 144705289) has the molecular formula C18H21N
and a molecular weight of 251.37 g/mol. Its IUPAC name is ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine.
Molecular Properties
| Compound Name | ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine |
| PubChem CID | 144705289 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine |
| SMILES | C=Nc1ccccc1C(=C)C.CCc1ccccc1 |
| InChI | InChI=1S/C10H11N.C8H10/c1-8(2)9-6-4-5-7-10(9)11-3;1-2-8-6-4-3-5-7-8/h4-7H,1,3H2,2H3;3-7H,2H2,1H3 |
| InChIKey | ZGPIQXNWWXLYHM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine?
The IUPAC name of ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine (CID 144705289) is ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine.
What is the SMILES notation for ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine?
The canonical SMILES for ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine is C=Nc1ccccc1C(=C)C.CCc1ccccc1.
What is the InChIKey of ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine?
The InChIKey is ZGPIQXNWWXLYHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C8H10/c1-8(2)9-6-4-5-7-10(9)11-3;1-2-8-6-4-3-5-7-8/h4-7H,1,3H2,2H3;3-7H,2H2,1H3.
What are the key properties of ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine?
ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine has a molecular weight of 251.37 g/mol, XLogP of 5.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;N-(2-prop-1-en-2-ylphenyl)methanimine is sourced from PubChem (CID 144705289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).