C11H13AsN2O5 — CID 137183643
[2-[[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]diazenyl]phenyl]arsonic acid (PubChem CID 137183643) has the molecular formula C11H13AsN2O5 and a molecular weight of 328.16 g/mol. Its IUPAC name is [2-[[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]diazenyl]phenyl]arsonic acid.
| Compound Name | [2-[[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]diazenyl]phenyl]arsonic acid |
|---|---|
| PubChem CID | 137183643 |
| Molecular Formula | C11H13AsN2O5 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | [2-[[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]diazenyl]phenyl]arsonic acid |
| SMILES | CC(=O)C(/N=N/c1ccccc1[As](=O)(O)O)=C(\C)O |
| InChI | InChI=1S/C11H13AsN2O5/c1-7(15)11(8(2)16)14-13-10-6-4-3-5-9(10)12(17,18)19/h3-6,15H,1-2H3,(H2,17,18,19)/b11-7-,14-13+ |
| InChIKey | YEHWKWLZUTWBSV-UKCOVKCYSA-N |
| XLogP | 0.71 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|