C11H10F2N2O2 — CID 135411653
(Z)-3-[(2,6-difluorophenyl)diazenyl]-4-hydroxypent-3-en-2-one (PubChem CID 135411653) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is (Z)-3-[(2,6-difluorophenyl)diazenyl]-4-hydroxypent-3-en-2-one.
| Compound Name | (Z)-3-[(2,6-difluorophenyl)diazenyl]-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 135411653 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (Z)-3-[(2,6-difluorophenyl)diazenyl]-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)C(/N=N/c1c(F)cccc1F)=C(\C)O |
| InChI | InChI=1S/C11H10F2N2O2/c1-6(16)10(7(2)17)14-15-11-8(12)4-3-5-9(11)13/h3-5,16H,1-2H3/b10-6-,15-14+ |
| InChIKey | OEEQHXFNRGGFDQ-PGFMTHIQSA-N |
| XLogP | 3.43 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|