C17H18F2N4O3 — CID 137228627
ethyl (Z)-2-[(2,6-difluorophenyl)diazenyl]-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxyprop-2-enoate (PubChem CID 137228627) has the molecular formula C17H18F2N4O3 and a molecular weight of 364.35 g/mol. Its IUPAC name is ethyl (Z)-2-[(2,6-difluorophenyl)diazenyl]-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-2-[(2,6-difluorophenyl)diazenyl]-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 137228627 |
| Molecular Formula | C17H18F2N4O3 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | ethyl (Z)-2-[(2,6-difluorophenyl)diazenyl]-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(/N=N/c1c(F)cccc1F)=C(/O)c1cc(C)nn1CC |
| InChI | InChI=1S/C17H18F2N4O3/c1-4-23-13(9-10(3)22-23)16(24)15(17(25)26-5-2)21-20-14-11(18)7-6-8-12(14)19/h6-9,24H,4-5H2,1-3H3/b16-15-,21-20+ |
| InChIKey | LUGRSOWKOGRODC-SHRYNFLWSA-N |
| XLogP | 4.06 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|