C18H23N3OSi — CID 156788555
(Z)-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxy-2-(4-trimethylsilylphenyl)prop-2-enenitrile (PubChem CID 156788555) has the molecular formula C18H23N3OSi and a molecular weight of 325.49 g/mol. Its IUPAC name is (Z)-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxy-2-(4-trimethylsilylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxy-2-(4-trimethylsilylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 156788555 |
| Molecular Formula | C18H23N3OSi |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (Z)-3-(2-ethyl-5-methylpyrazol-3-yl)-3-hydroxy-2-(4-trimethylsilylphenyl)prop-2-enenitrile |
| SMILES | CCn1nc(C)cc1/C(O)=C(/C#N)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H23N3OSi/c1-6-21-17(11-13(2)20-21)18(22)16(12-19)14-7-9-15(10-8-14)23(3,4)5/h7-11,22H,6H2,1-5H3/b18-16+ |
| InChIKey | IVWQAYUGROXTFR-FBMGVBCBSA-N |
| XLogP | 3.71 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|