C20H27N3O3SSi — CID 175445318
[(Z)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] ethanesulfonate (PubChem CID 175445318) has the molecular formula C20H27N3O3SSi and a molecular weight of 417.61 g/mol. Its IUPAC name is [(Z)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] ethanesulfonate.
| Compound Name | [(Z)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] ethanesulfonate |
|---|---|
| PubChem CID | 175445318 |
| Molecular Formula | C20H27N3O3SSi |
| Molecular Weight | 417.61 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [(Z)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] ethanesulfonate |
| SMILES | CCn1nc(C)cc1/C(OS(=O)(=O)CC)=C(/C#N)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C20H27N3O3SSi/c1-7-23-19(13-15(3)22-23)20(26-27(24,25)8-2)18(14-21)16-9-11-17(12-10-16)28(4,5)6/h9-13H,7-8H2,1-6H3/b20-18+ |
| InChIKey | SDCILXNIIOOBHR-CZIZESTLSA-N |
| XLogP | 3.51 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|