C25H33N3O5 — CID 155243954
1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenoxy]ethyl 2-methoxyethyl carbonate (PubChem CID 155243954) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenoxy]ethyl 2-methoxyethyl carbonate.
| Compound Name | 1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenoxy]ethyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 155243954 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenoxy]ethyl 2-methoxyethyl carbonate |
| SMILES | CCn1nc(C)cc1/C(OC(C)OC(=O)OCCOC)=C(\C#N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H33N3O5/c1-8-28-22(15-17(2)27-28)23(32-18(3)33-24(29)31-14-13-30-7)21(16-26)19-9-11-20(12-10-19)25(4,5)6/h9-12,15,18H,8,13-14H2,1-7H3/b23-21- |
| InChIKey | ROYNYEWPSMXNPT-LNVKXUELSA-N |
| XLogP | 5.06 |
| TPSA | 95.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|