C24H33N3O2Si — CID 156788993
[(E)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] 2-ethylbutanoate (PubChem CID 156788993) has the molecular formula C24H33N3O2Si and a molecular weight of 423.63 g/mol. Its IUPAC name is [(E)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] 2-ethylbutanoate.
| Compound Name | [(E)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] 2-ethylbutanoate |
|---|---|
| PubChem CID | 156788993 |
| Molecular Formula | C24H33N3O2Si |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | [(E)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)O/C(=C(/C#N)c1ccc([Si](C)(C)C)cc1)c1cc(C)nn1CC |
| InChI | InChI=1S/C24H33N3O2Si/c1-8-18(9-2)24(28)29-23(22-15-17(4)26-27(22)10-3)21(16-25)19-11-13-20(14-12-19)30(5,6)7/h11-15,18H,8-10H2,1-7H3/b23-21- |
| InChIKey | BUAAAPJNHXWDGY-LNVKXUELSA-N |
| XLogP | 5.13 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|