C23H31N3O2Si — CID 156788998
[(E)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenyl] 2-(4-trimethylsilylphenyl)pentanoate (PubChem CID 156788998) has the molecular formula C23H31N3O2Si and a molecular weight of 409.61 g/mol. Its IUPAC name is [(E)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenyl] 2-(4-trimethylsilylphenyl)pentanoate.
| Compound Name | [(E)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenyl] 2-(4-trimethylsilylphenyl)pentanoate |
|---|---|
| PubChem CID | 156788998 |
| Molecular Formula | C23H31N3O2Si |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | [(E)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenyl] 2-(4-trimethylsilylphenyl)pentanoate |
| SMILES | CCCC(C(=O)O/C(=C/C#N)c1cc(C)nn1CC)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C23H31N3O2Si/c1-7-9-20(18-10-12-19(13-11-18)29(4,5)6)23(27)28-22(14-15-24)21-16-17(3)25-26(21)8-2/h10-14,16,20H,7-9H2,1-6H3/b22-14+ |
| InChIKey | PELCHMYHGIVNCG-HYARGMPZSA-N |
| XLogP | 4.75 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|