C18H19N3O2 — CID 98347406
(2R)-2-(2,4-dimethylbenzoyl)-3-(2-ethyl-5-methylpyrazol-3-yl)-3-oxopropanenitrile (PubChem CID 98347406) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is (2R)-2-(2,4-dimethylbenzoyl)-3-(2-ethyl-5-methylpyrazol-3-yl)-3-oxopropanenitrile.
| Compound Name | (2R)-2-(2,4-dimethylbenzoyl)-3-(2-ethyl-5-methylpyrazol-3-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 98347406 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (2R)-2-(2,4-dimethylbenzoyl)-3-(2-ethyl-5-methylpyrazol-3-yl)-3-oxopropanenitrile |
| SMILES | CCn1nc(C)cc1C(=O)[C@H](C#N)C(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C18H19N3O2/c1-5-21-16(9-13(4)20-21)18(23)15(10-19)17(22)14-7-6-11(2)8-12(14)3/h6-9,15H,5H2,1-4H3/t15-/m1/s1 |
| InChIKey | GVXCXRWZOFRMOM-OAHLLOKOSA-N |
| XLogP | 3.03 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|