C19H25N3O3SSi — CID 175157014
[2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] methanesulfonate (PubChem CID 175157014) has the molecular formula C19H25N3O3SSi and a molecular weight of 403.58 g/mol. Its IUPAC name is [2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] methanesulfonate.
| Compound Name | [2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] methanesulfonate |
|---|---|
| PubChem CID | 175157014 |
| Molecular Formula | C19H25N3O3SSi |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)-2-(4-trimethylsilylphenyl)ethenyl] methanesulfonate |
| SMILES | CCn1nc(C)cc1C(OS(C)(=O)=O)=C(C#N)c1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C19H25N3O3SSi/c1-7-22-18(12-14(2)21-22)19(25-26(3,23)24)17(13-20)15-8-10-16(11-9-15)27(4,5)6/h8-12H,7H2,1-6H3 |
| InChIKey | WQPFVWLGOVZFAF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|