C24H29N3O4 — CID 139236850
[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenyl] oxolan-3-yl carbonate (PubChem CID 139236850) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is [(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenyl] oxolan-3-yl carbonate.
| Compound Name | [(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenyl] oxolan-3-yl carbonate |
|---|---|
| PubChem CID | 139236850 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | [(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenyl] oxolan-3-yl carbonate |
| SMILES | CCn1nc(C)cc1/C(OC(=O)OC1CCOC1)=C(\C#N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-6-27-21(13-16(2)26-27)22(31-23(28)30-19-11-12-29-15-19)20(14-25)17-7-9-18(10-8-17)24(3,4)5/h7-10,13,19H,6,11-12,15H2,1-5H3/b22-20- |
| InChIKey | VVUGPIPMNRMYEH-XDOYNYLZSA-N |
| XLogP | 4.84 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|