C27H37N3O3 — CID 155243586
1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-4,5-dimethylpyrazol-3-yl)ethenoxy]ethyl 2,2-dimethylpropanoate (PubChem CID 155243586) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-4,5-dimethylpyrazol-3-yl)ethenoxy]ethyl 2,2-dimethylpropanoate.
| Compound Name | 1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-4,5-dimethylpyrazol-3-yl)ethenoxy]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 155243586 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-4,5-dimethylpyrazol-3-yl)ethenoxy]ethyl 2,2-dimethylpropanoate |
| SMILES | CCn1nc(C)c(C)c1/C(OC(C)OC(=O)C(C)(C)C)=C(\C#N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H37N3O3/c1-11-30-23(17(2)18(3)29-30)24(32-19(4)33-25(31)27(8,9)10)22(16-28)20-12-14-21(15-13-20)26(5,6)7/h12-15,19H,11H2,1-10H3/b24-22- |
| InChIKey | IXVANXYEEKAPIF-GYHWCHFESA-N |
| XLogP | 6.16 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|