C23H28FN3O3 — CID 155630895
1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2,4,5-trimethylpyrazol-3-yl)ethenoxy]ethyl 2-fluoroacetate (PubChem CID 155630895) has the molecular formula C23H28FN3O3 and a molecular weight of 413.49 g/mol. Its IUPAC name is 1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2,4,5-trimethylpyrazol-3-yl)ethenoxy]ethyl 2-fluoroacetate.
| Compound Name | 1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2,4,5-trimethylpyrazol-3-yl)ethenoxy]ethyl 2-fluoroacetate |
|---|---|
| PubChem CID | 155630895 |
| Molecular Formula | C23H28FN3O3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2,4,5-trimethylpyrazol-3-yl)ethenoxy]ethyl 2-fluoroacetate |
| SMILES | Cc1nn(C)c(/C(OC(C)OC(=O)CF)=C(\C#N)c2ccc(C(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C23H28FN3O3/c1-14-15(2)26-27(7)21(14)22(30-16(3)29-20(28)12-24)19(13-25)17-8-10-18(11-9-17)23(4,5)6/h8-11,16H,12H2,1-7H3/b22-19- |
| InChIKey | ZBHOJBDWSNOTKJ-QOCHGBHMSA-N |
| XLogP | 4.60 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|