C27H28ClN3O3 — CID 155243445
1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-cyanoethenoxy]ethyl benzoate (PubChem CID 155243445) has the molecular formula C27H28ClN3O3 and a molecular weight of 477.99 g/mol. Its IUPAC name is 1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-cyanoethenoxy]ethyl benzoate.
| Compound Name | 1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-cyanoethenoxy]ethyl benzoate |
|---|---|
| PubChem CID | 155243445 |
| Molecular Formula | C27H28ClN3O3 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1,3-dimethylpyrazol-5-yl)-2-cyanoethenoxy]ethyl benzoate |
| SMILES | Cc1nn(C)c(/C(OC(C)OC(=O)c2ccccc2)=C(\C#N)c2ccc(C(C)(C)C)cc2)c1Cl |
| InChI | InChI=1S/C27H28ClN3O3/c1-17-23(28)24(31(6)30-17)25(33-18(2)34-26(32)20-10-8-7-9-11-20)22(16-29)19-12-14-21(15-13-19)27(3,4)5/h7-15,18H,1-6H3/b25-22- |
| InChIKey | RLMNEBKLZHSBJD-LVWGJNHUSA-N |
| XLogP | 6.29 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|