C29H34ClN3O3 — CID 155243512
1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]ethyl benzoate (PubChem CID 155243512) has the molecular formula C29H34ClN3O3 and a molecular weight of 508.06 g/mol. Its IUPAC name is 1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]ethyl benzoate.
| Compound Name | 1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]ethyl benzoate |
|---|---|
| PubChem CID | 155243512 |
| Molecular Formula | C29H34ClN3O3 |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 1-[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]ethyl benzoate |
| SMILES | CCn1nc(C)c(Cl)c1/C(OC(C)OC(=O)c1ccccc1)=C(\C=N\C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H34ClN3O3/c1-8-33-26(25(30)19(2)32-33)27(35-20(3)36-28(34)22-12-10-9-11-13-22)24(18-31-7)21-14-16-23(17-15-21)29(4,5)6/h9-18,20H,8H2,1-7H3/b27-24-,31-18+ |
| InChIKey | HESWBQXIDCINLD-GYKKLVGRSA-N |
| XLogP | 6.95 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|