C25H34ClN3O5 — CID 155243498
[(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-methoxyethyl carbonate (PubChem CID 155243498) has the molecular formula C25H34ClN3O5 and a molecular weight of 492.02 g/mol. Its IUPAC name is [(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-methoxyethyl carbonate.
| Compound Name | [(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 155243498 |
| Molecular Formula | C25H34ClN3O5 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | [(E)-2-(4-tert-butylphenyl)-1-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-3-methyliminoprop-1-enoxy]methyl 2-methoxyethyl carbonate |
| SMILES | CCn1nc(C)c(Cl)c1/C(OCOC(=O)OCCOC)=C(\C=N\C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H34ClN3O5/c1-8-29-22(21(26)17(2)28-29)23(33-16-34-24(30)32-14-13-31-7)20(15-27-6)18-9-11-19(12-10-18)25(3,4)5/h9-12,15H,8,13-14,16H2,1-7H3/b23-20-,27-15+ |
| InChIKey | CKCFAFRKVNZVBF-KMGDYSPESA-N |
| XLogP | 5.50 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|